For research use only. Not for therapeutic Use.
1,1-Diamino-2,2-dinitroethene(Cat No.:M104427), commonly referred to as FOX-7, is a high-energy, low-sensitivity explosive compound. This material is noted for its exceptional stability, making it safer to handle compared to traditional explosives like TNT. FOX-7 exhibits both high detonation velocity and pressure, characteristics that make it highly desirable in military applications. The molecular structure features a nitro group and amino group on each carbon of the ethene backbone, contributing to its energetic and stable properties.
CAS Number | 145250-81-3 |
Molecular Formula | C2H4N4O4 |
Purity | ≥95% |
Storage | Store at -20C |
IUPAC Name | 2,2-dinitroethene-1,1-diamine |
InChI | InChI=1S/C2H4N4O4/c3-1(4)2(5(7)8)6(9)10/h3-4H2 |
InChIKey | FUHQFAMVYDIUKL-UHFFFAOYSA-N |
SMILES | C(=C([N+](=O)[O-])[N+](=O)[O-])(N)N |