For research use only. Not for therapeutic Use.
1,1-Dibromoethane (Cat No.:C000969) is an organic compound. It is a colorless liquid with a strong and unpleasant odor. 1,1-Dibromoethane is primarily used as an industrial chemical and as a lead scavenger in gasoline to prevent engine knocking. However, its use has been limited due to its toxicity and potential to form harmful byproducts. It is also used in the production of other chemicals and as a solvent in some applications.
| Catalog Number | C000969 |
| CAS Number | 557-91-5 |
| Synonyms | Ethylidene Dibromide |
| Molecular Formula | C₂H₄Br₂ |
| Purity | ≥95% |
| Solubility | Acetonitrile (Slightly), Chloroform (Soluble) |
| Appearance | Colourless Oil |
| Storage | 4°C, Inert atmosphere |
| IUPAC Name | 1,1-dibromoethane |
| InChI | InChI=1S/C2H4Br2/c1-2(3)4/h2H,1H3 |
| InChIKey | APQIUTYORBAGEZ-UHFFFAOYSA-N |
| SMILES | CC(Br)Br |
