For research use only. Not for therapeutic Use.
1,1-Dimethoxydecane (Cat.No:R043883) is a chemical compound with two methoxy (CH3-O-) groups attached to a decane backbone. It finds application as a coupling agent, solvent, or intermediate in chemical synthesis. This compound’s unique structure makes it valuable in diverse industries including pharmaceuticals, agrochemicals, and materials science.
CAS Number | 7779-41-1 |
Synonyms | Dimethyl Acetal Decanal; NSC 46132 |
Molecular Formula | C12H26O2 |
Purity | ≥95% |
Storage | 4°C |
IUPAC Name | 1,1-dimethoxydecane |
InChI | InChI=1S/C12H26O2/c1-4-5-6-7-8-9-10-11-12(13-2)14-3/h12H,4-11H2,1-3H3 |
InChIKey | NCRNCSZWOOYBQF-UHFFFAOYSA-N |
SMILES | CCCCCCCCCC(OC)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |