For research use only. Not for therapeutic Use.
1,1-Dimethylhydrazine (UDMH) is a highly reactive and toxic liquid used primarily as a rocket propellant. Its colorless to pale yellow appearance belies its strong, ammonia-like odor. Despite its hazards, UDMH’s high energy density and stability make it valuable in aerospace applications, particularly in combination with oxidizers like nitrogen tetroxide. However, exposure to UDMH presents significant health risks, including neurological and respiratory effects, as well as potential carcinogenicity. Stringent safety protocols and protective measures are essential during its handling and storage to minimize the risk to personnel and the environment.
| Catalog Number | R069008 |
| CAS Number | 57-14-7 |
| Synonyms | Unsymmetrical Dimazine |
| Molecular Formula | C2H8N2 |
| Purity | ≥95% |
| Storage | RT |
| IUPAC Name | 1,1-dimethylhydrazine |
| InChI | InChI=1S/C2H8N2/c1-4(2)3/h3H2,1-2H3 |
| InChIKey | RHUYHJGZWVXEHW-UHFFFAOYSA-N |
| SMILES | CN(C)N |
