1,1-Diphenylbut-3-en-1-amine（Cat No.:L007807）, is a chemical compound featuring a butenamine structure. This compound consists of a phenyl group attached to both the first carbon (C1) and third carbon (C3) of the butenamine backbone, indicating a diphenyl substitution pattern. The amine functional group (NH2) is located at the terminal carbon (C1) of the butenamine chain. Compounds with similar structures often find applications in organic synthesis, medicinal chemistry, and materials science, where specific arrangements of functional groups can lead to unique properties or biological activities.
| Catalog Number | L007807 |
| CAS Number | 356762-89-5 |
| Molecular Formula | C16H17N |
| Purity | ≥95% |
| IUPAC Name | 1,1-diphenylbut-3-en-1-amine |
| InChI | InChI=1S/C16H17N/c1-2-13-16(17,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h2-12H,1,13,17H2 |
| InChIKey | UCQGGAFNVOYFAD-UHFFFAOYSA-N |
| SMILES | C=CCC(C1=CC=CC=C1)(C2=CC=CC=C2)N |
