For research use only. Not for therapeutic Use.
1,1-Diphenylheptane（Cat No.:M048520） is an organic compound consisting of a heptane backbone with a phenyl group attached to each of the first and second carbon atoms. This structure classifies it as a diarylalkane, combining aspects of aliphatic and aromatic hydrocarbons. 1,1-Diphenylheptane is primarily of interest in organic chemistry for synthetic applications and as a precursor in the synthesis of various complex molecules. Its bulky phenyl groups influence its physical properties and reactivity, making it useful in studying steric effects in chemical reactions. It also has potential applications in materials science and pharmaceuticals, exploring new materials and therapeutic agents.
| Catalog Number | M048520 |
| CAS Number | 1530-05-8 |
| Molecular Formula | C19H24 |
| Purity | ≥95% |
| Storage | Desiccate at -20C |
| IUPAC Name | 1-phenylheptylbenzene |
| InChI | InChI=1S/C19H24/c1-2-3-4-11-16-19(17-12-7-5-8-13-17)18-14-9-6-10-15-18/h5-10,12-15,19H,2-4,11,16H2,1H3 |
| InChIKey | MZLKNWMNBXHXMA-UHFFFAOYSA-N |
| SMILES | CCCCCCC(C1=CC=CC=C1)C2=CC=CC=C2 |
