For research use only. Not for therapeutic Use.
(1,1′-Dipyrenyl)dimethyl ether（Cat No.:R020605）is an organic compound consisting of two pyrene moieties connected by a dimethyl ether linker. This molecule exhibits unique optical properties, including fluorescence and photophysical behavior, making it useful in various applications like organic electronics, fluorescence sensors, and materials science. The pyrene units provide strong light absorption and emission characteristics, while the dimethyl ether linker enhances solubility and stability. Research has explored its potential in the development of light-emitting devices, molecular sensors, and as a building block in supramolecular chemistry due to its ability to form π-stacked structures.
| CAS Number | 74833-81-1 |
| Synonyms | 1-(pyren-1-ylmethoxymethyl)pyrene |
| Molecular Formula | C34H22O |
| Purity | ≥95% |
| IUPAC Name | 1-(pyren-1-ylmethoxymethyl)pyrene |
| InChI | InChI=1S/C34H22O/c1-3-21-7-9-25-11-13-27(29-17-15-23(5-1)31(21)33(25)29)19-35-20-28-14-12-26-10-8-22-4-2-6-24-16-18-30(28)34(26)32(22)24/h1-18H,19-20H2 |
| InChIKey | KDWSQWLDGXGQTK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C=CC4=C(C=CC(=C43)C=C2)COCC5=C6C=CC7=CC=CC8=C7C6=C(C=C8)C=C5 |
| Reference |
|
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
