For research use only. Not for therapeutic Use.
11-Maleimidoundecanoic acid (Cat No.:R000679) is a chemical compound. It features a maleimide group attached to an 11-carbon aliphatic chain. This compound is significant in bioconjugation and chemical research due to its applications in various reactions. Maleimide-functionalized compounds like this are commonly used for cross-linking and modification of biomolecules. The presence of a maleimide group adds reactivity toward thiol-containing compounds, facilitating conjugation with proteins, peptides, and other molecules.
CAS Number | 57079-01-3 |
Synonyms | N-(10-Carboxydecyl)maleimide; 2,5-Dihydro-2,5-dioxo-1H-pyrrole-1-undecanoic Acid; |
Molecular Formula | C15H23NO4 |
Purity | ≥95% |
Target | PROTAC Linkers |
Storage | Store at -20°C |
IUPAC Name | 11-(2,5-dioxopyrrol-1-yl)undecanoic acid |
InChI | InChI=1S/C15H23NO4/c17-13-10-11-14(18)16(13)12-8-6-4-2-1-3-5-7-9-15(19)20/h10-11H,1-9,12H2,(H,19,20) |
InChIKey | UVZTZBRGZXIBLZ-UHFFFAOYSA-N |
SMILES | C1=CC(=O)N(C1=O)CCCCCCCCCCC(=O)O |