For research use only. Not for therapeutic Use.
11-Methoxy-11-oxoundecanoic acid(CAT: L010533) is a specialized organic compound featuring a methoxy and ketone functional group along an undecanoic acid backbone. This compound is valuable in pharmaceutical and biochemical research for its role as an intermediate in the synthesis of bioactive molecules and specialty chemicals. Its versatile structure makes it suitable for exploring chemical modifications, particularly in the development of lipid-related derivatives and metabolic studies. Produced with high purity, 11-Methoxy-11-oxoundecanoic acid ensures reliable performance in research applications, including drug discovery, medicinal chemistry, and enzymatic studies. Its stability and reactivity offer broad applicability in innovative scientific investigations.
CAS Number | 3927-60-4 |
Molecular Formula | C12H22O4 |
Purity | ≥95% |
IUPAC Name | 11-methoxy-11-oxoundecanoic acid |
InChI | InChI=1S/C12H22O4/c1-16-12(15)10-8-6-4-2-3-5-7-9-11(13)14/h2-10H2,1H3,(H,13,14) |
InChIKey | JAELIPKEGUQPKD-UHFFFAOYSA-N |
SMILES | COC(=O)CCCCCCCCCC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |