For research use only. Not for therapeutic Use.
11-Methyloctadeca-12-enoic acid(Cat No.:M108605) is a fatty acid characterized by a long carbon chain with a methyl group attached to the eleventh carbon and a double bond at the twelfth position. This molecular structure categorizes it as an unsaturated fatty acid with specific chemical and physical properties, such as a higher melting point and enhanced reactivity compared to its saturated counterparts. It is significant in various industrial and biochemical applications, including the synthesis of surfactants, lubricants, and potentially pharmaceuticals.
CAS Number | 129177-01-1 |
Synonyms | 11-methyloctadeca-12-enoic acid |
Molecular Formula | C19H36O2 |
Purity | ≥95% |
Storage | Desiccate at +4C |
IUPAC Name | (E)-11-methyloctadec-12-enoic acid |
InChI | InChI=1S/C19H36O2/c1-3-4-5-9-12-15-18(2)16-13-10-7-6-8-11-14-17-19(20)21/h12,15,18H,3-11,13-14,16-17H2,1-2H3,(H,20,21)/b15-12+ |
InChIKey | ATAFFFIQYLMZPZ-NTCAYCPXSA-N |
SMILES | CCCCCC=CC(C)CCCCCCCCCC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |