For research use only. Not for therapeutic Use.
1,10-Bis(acryloyloxy)decane (Cat.No:M062044) is a bifunctional compound used in polymer chemistry, particularly in the synthesis of cross-linked polymers and hydrogels. Its two acryloyloxy functional groups enable it to serve as a versatile cross-linking agent in the creation of polymers with desirable properties for various applications, including drug delivery and tissue engineering.
CAS Number | 13048-34-5 |
Molecular Formula | C16H26O4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 10-prop-2-enoyloxydecyl prop-2-enoate |
InChI | InChI=1S/C16H26O4/c1-3-15(17)19-13-11-9-7-5-6-8-10-12-14-20-16(18)4-2/h3-4H,1-2,5-14H2 |
InChIKey | RHNJVKIVSXGYBD-UHFFFAOYSA-N |
SMILES | C=CC(=O)OCCCCCCCCCCOC(=O)C=C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |