Home
>
Chemical Reagents>Heterocyclic Building Blocks> 11,12-Didehydro-|A-oxodibenz[b,f]azocine-5(6H)-pentanoic acid
For research use only. Not for therapeutic Use.
11,12-Didehydro-Δ^9-oxodibenz[b,f]azocine-5(6H)-pentanoic acid(CAT: L000561) is a compound of significance in organic chemistry, particularly in the realm of the synthesis of complex organic molecules. This chemical features a unique structure that makes it a valuable building block for the development of various organic compounds.
CAS Number | 1207355-31-4 |
Molecular Formula | C20H17NO3 |
Purity | ≥95% |
Target | ADC Linker |
IUPAC Name | 5-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-5-oxopentanoic acid |
InChI | InChI=1S/C20H17NO3/c22-19(10-5-11-20(23)24)21-14-17-8-2-1-6-15(17)12-13-16-7-3-4-9-18(16)21/h1-4,6-9H,5,10-11,14H2,(H,23,24) |
InChIKey | KDYPHAQTQRXDCD-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |