For research use only. Not for therapeutic Use.
1,1,3-Trichloro-1-propene (Cat No.:R037159) is a chemical compound with the molecular formula C3H3Cl3. It is a colorless liquid that belongs to the class of chlorinated hydrocarbons. This compound is used primarily as an intermediate in the production of other chemicals, including agrochemicals and pharmaceuticals. Its reactive nature makes it valuable for various synthetic processes, such as the preparation of insecticides and herbicides. However, due to its potential health and environmental hazards, proper handling and safety precautions are essential when working with 1,1,3-trichloro-1-propene.
CAS Number | 2567-14-8 |
Synonyms | 1,1,3-Trichloropropene; 1,3,3-Trichloro-2-propene; 3,3-Dichloroallyl Chloride; HCC 1240za; 1,1,3-Trichloroprop-1-ene; |
Molecular Formula | C3H3Cl3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1,1,3-trichloroprop-1-ene |
InChI | InChI=1S/C3H3Cl3/c4-2-1-3(5)6/h1H,2H2 |
InChIKey | JFEVIPGMXQNRRF-UHFFFAOYSA-N |
SMILES | C(C=C(Cl)Cl)Cl |