For research use only. Not for therapeutic Use.
1,1,3,3-Tetrachloro-1,3-dimethyldisiloxane is an organosilicon compound featuring two silicon atoms bonded by an oxygen atom, with four chlorine atoms and two methyl groups attached to the silicon atoms. It is used as an intermediate in the production of silicone polymers and other organosilicon compounds. The presence of chlorine atoms allows for further chemical reactions, such as substitution or hydrolysis, to form siloxane chains, which are key components in the manufacture of silicone-based materials. These materials are widely used in various industries, including sealants, adhesives, lubricants, and coatings due to their thermal stability, flexibility, and water resistance.
CAS Number | 4617-27-0 |
Synonyms | 1,1,3,3-tetrachloro-1,3-dimethyldisiloxane;1,1,3,3-Tetrachloro-1,3-dimethylpropanedisiloxane;Einecs 225-025-6 |
Molecular Formula | C2H6Cl4OSi2 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | dichloro-[dichloro(methyl)silyl]oxy-methylsilane |
InChI | InChI=1S/C2H6Cl4OSi2/c1-8(3,4)7-9(2,5)6/h1-2H3 |
InChIKey | WAUFEDNTDWQARU-UHFFFAOYSA-N |
SMILES | C[Si](O[Si](C)(Cl)Cl)(Cl)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |