For research use only. Not for therapeutic Use.
1,1,3,3-Tetraethoxypropane-1,3-d2 (Cat No.: R001349) is a high-purity, deuterium-labeled compound essential for advanced chemical and biochemical research. This compound, featuring deuterium atoms at positions 1 and 3, is crucial for studying lipid peroxidation, oxidative stress, and reaction mechanisms. Its stable isotope labeling ensures precise and reliable results in mass spectrometry and NMR spectroscopy. Ideal for cutting-edge research in organic synthesis, analytical chemistry, and biomedical studies, 1,1,3,3-Tetraethoxypropane-1,3-d2 enhances the accuracy of experimental data, supporting advancements in scientific investigations.
Catalog Number | R001349 |
CAS Number | 105479-86-5 |
Molecular Formula | C₁₁H₂₂D₂O₄ |
Purity | ≥95% |
Storage | store at -20℃ |
IUPAC Name | 1,1,1,2,2-pentadeuterio-2-[tris(1,1,2,2,2-pentadeuterioethoxy)methoxy]ethane |
InChI | 1S/C9H20O4/c1-5-10-9(11-6-2,12-7-3)13-8-4/h5-8H2,1-4H3/i1D3,2D3,3D3,4D3,5D2,6D2,7D2,8D2 |
InChIKey | CWLNAJYDRSIKJS-DEHFLJNXSA-N |
SMILES | [2H]C([2H])([2H])C([2H])([2H])OC(OC([2H])([2H])C([2H])([2H])[2H])(OC([2H])([2H])C([2H])([2H])[2H])OC([2H])([2H])C([2H])([2H])[2H] |