Home
>
Materials Science>Organic ligands for MOF materials> [1,1':4',1''-Terphenyl]-2',3,3'',5,5',5''-hexacarboxylic acid
For research use only. Not for therapeutic Use.
[1,1′:4′,1”-Terphenyl]-2′,3,3”,5,5′,5”-hexacarboxylic acid (Cat.No:L003521) is a crucial compound in materials science. Its unique molecular structure makes it a valuable building block for the synthesis of specialized polymers, with potential applications in electronic devices and advanced materials.
CAS Number | 1542274-12-3 |
Molecular Formula | C24H14O12 |
Purity | ≥95% |
IUPAC Name | 2,5-bis(3,5-dicarboxyphenyl)terephthalic acid |
InChI | InChI=1S/C24H14O12/c25-19(26)11-1-9(2-12(5-11)20(27)28)15-7-18(24(35)36)16(8-17(15)23(33)34)10-3-13(21(29)30)6-14(4-10)22(31)32/h1-8H,(H,25,26)(H,27,28)(H,29,30)(H,31,32)(H,33,34)(H,35,36) |
InChIKey | WCMYVQOLWBUDDQ-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C=C1C(=O)O)C(=O)O)C2=CC(=C(C=C2C(=O)O)C3=CC(=CC(=C3)C(=O)O)C(=O)O)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |