For research use only. Not for therapeutic Use.
1,2-Bis(diphenylphosphine)ethane(Cat No.:M075432), commonly abbreviated as dpi, is a bidentate ligand widely employed in coordination chemistry and organometallic catalysis. Structurally, it features two phenylphosphine groups attached to a central ethylene backbone. Due to its chelating ability, dppe forms stable complexes with various transition metals, such as palladium, platinum, and nickel. These complexes exhibit diverse reactivity and catalytic activity, including applications in cross-coupling reactions, hydrogenation, and C-C bond formation. Additionally, dope-containing complexes are utilized in homogeneous catalysis for organic synthesis, pharmaceutical production, and materials science, contributing to the development of new chemical processes and functional materials.
CAS Number | 18899-64-4 |
Molecular Formula | C14H16P2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | phenyl(2-phenylphosphanylethyl)phosphane |
InChI | InChI=1S/C14H16P2/c1-3-7-13(8-4-1)15-11-12-16-14-9-5-2-6-10-14/h1-10,15-16H,11-12H2 |
InChIKey | VBXSERPGINMTDE-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)PCCPC2=CC=CC=C2 |