For research use only. Not for therapeutic Use.
1,2-Bis(4-bromophenyl)-1,2-diphenylethene(CAT: L000431) is a significant compound used primarily in organic chemistry. This molecule serves as a valuable building block for the synthesis of various organic compounds, especially in the creation of specialized chemical reagents and intermediates. Its unique structure, containing multiple aromatic rings and bromine substituents, is instrumental in organic transformations and the formation of complex organic molecules.
Catalog Number | L000431 |
CAS Number | 184239-35-8 |
Molecular Formula | C26H18Br2 |
Purity | ≥95% |
IUPAC Name | 1-bromo-4-[(E)-2-(4-bromophenyl)-1,2-diphenylethenyl]benzene |
InChI | InChI=1S/C26H18Br2/c27-23-15-11-21(12-16-23)25(19-7-3-1-4-8-19)26(20-9-5-2-6-10-20)22-13-17-24(28)18-14-22/h1-18H/b26-25+ |
InChIKey | BBSNJTOHVHUCRF-OCEACIFDSA-N |