For research use only. Not for therapeutic Use.
12-Chlorododecanoic acid (Cat No.:C000935) is an organic compound. It is a white to off-white crystalline solid and belongs to the family of chlorinated fatty acids. This compound is used as an intermediate in organic synthesis, particularly in the production of various chemical compounds and specialty chemicals. It contains both a chloro and a carboxylic acid functional group, making it valuable in various chemical reactions to form different derivatives.
| Catalog Number | C000935 |
| CAS Number | 22075-86-1 |
| Synonyms | NSC 667272; |
| Molecular Formula | C₁₂H₂₃ClO₂ |
| Purity | ≥95% |
| Solubility | Chloroform (Slightly), DMSO (Slightly) |
| Appearance | Off-White to Pale Brown Low-Melting Solid |
| Storage | 4°C, Inert atmosphere |
| IUPAC Name | 12-chlorododecanoic acid |
| InChI | InChI=1S/C12H23ClO2/c13-11-9-7-5-3-1-2-4-6-8-10-12(14)15/h1-11H2,(H,14,15) |
| InChIKey | CSQLFBKZQRLUFP-UHFFFAOYSA-N |
| SMILES | C(CCCCCC(=O)O)CCCCCCl |
| Reference | Shi, X., et al.: Jingxi Huagong, 30, 911-914 (2013); Kubienova, L., et. al.: Biochimie, 95, 889 (2013) |
