For research use only. Not for therapeutic Use.
1,2-Di(4-boronophenoxy)ethane, dipinacol ester(Cat No.:L025121)is a boronic ester compound featuring two boronophenoxy groups attached to an ethane backbone and stabilized by pinacol ester groups. This compound is commonly used in organic synthesis, particularly in Suzuki-Miyaura cross-coupling reactions to form carbon-carbon bonds. Its boron groups provide reactivity that enables the formation of complex molecular architectures, making it valuable in pharmaceutical research for developing drug candidates and advanced materials.
CAS Number | 957061-07-3 |
Molecular Formula | C26H36B2O6 |
Purity | ≥95% |
IUPAC Name | 4,4,5,5-tetramethyl-2-[4-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethoxy]phenyl]-1,3,2-dioxaborolane |
InChI | InChI=1S/C26H36B2O6/c1-23(2)24(3,4)32-27(31-23)19-9-13-21(14-10-19)29-17-18-30-22-15-11-20(12-16-22)28-33-25(5,6)26(7,8)34-28/h9-16H,17-18H2,1-8H3 |
InChIKey | WYXYACQNJWQTSI-UHFFFAOYSA-N |
SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OCCOC3=CC=C(C=C3)B4OC(C(O4)(C)C)(C)C |