For research use only. Not for therapeutic Use.
1,2-Diaminoanthraquinone(CAT: M122185) is a high-purity aromatic compound widely utilized in pharmaceutical, dye, and material science research. Featuring amino groups at the 1 and 2 positions of the anthraquinone core, this compound exhibits versatile reactivity, making it a valuable intermediate for synthesizing dyes, pigments, and advanced organic materials. Its robust aromatic structure ensures stability, while its functional groups enable precise modification in various chemical pathways. 1,2-Diaminoanthraquinone supports innovative applications in organic synthesis, electronics, and bioactive compound development, providing reliable performance and consistency for researchers exploring cutting-edge solutions in diverse scientific fields.
| Catalog Number | M122185 |
| CAS Number | 1758-68-5 |
| Synonyms | 1,2-diaminoanthracene-9,10-dione |
| Molecular Formula | C14H10N2O2 |
| Purity | ≥95% |
| IUPAC Name | 1,2-diaminoanthracene-9,10-dione |
| InChI | InChI=1S/C14H10N2O2/c15-10-6-5-9-11(12(10)16)14(18)8-4-2-1-3-7(8)13(9)17/h1-6H,15-16H2 |
| InChIKey | LRMDXTVKVHKWEK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C(=C(C=C3)N)N |
