For research use only. Not for therapeutic Use.
1,2-Dibromo-4-tert-butylbenzene(Cat No.:L044152)is a brominated aromatic compound featuring a tert-butyl group attached to a benzene ring, which is further substituted with two bromine atoms. This structure enhances its chemical reactivity, making it a useful intermediate in the synthesis of polymers, fire retardants, and various organic compounds. The presence of bromine atoms allows for electrophilic substitution reactions, crucial in further chemical modifications. The tert-butyl group increases the steric hindrance, affecting the molecule’s reactivity and stability. This compound is valuable in creating advanced materials with improved performance characteristics.
CAS Number | 6683-75-6 |
Molecular Formula | C10H12Br2 |
Purity | ≥95% |
IUPAC Name | 1,2-dibromo-4-tert-butylbenzene |
InChI | InChI=1S/C10H12Br2/c1-10(2,3)7-4-5-8(11)9(12)6-7/h4-6H,1-3H3 |
InChIKey | LZOUMICSOKCMJT-UHFFFAOYSA-N |
SMILES | CC(C)(C)C1=CC(=C(C=C1)Br)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |