For research use only. Not for therapeutic Use.
1,2-Dibromonaphthalene(CAT: L000012) is a chemical compound primarily utilized in organic chemistry. It serves as a crucial reagent and intermediate for the synthesis of various organic compounds, enabling the development of molecules with diverse applications. In the field of organic chemistry, this compound plays a pivotal role in the diversification of chemical synthesis and the creation of specialized molecules with unique properties, making it valuable for researchers and chemists in this domain.
CAS Number | 5438-13-1 |
Molecular Formula | C10H6Br2 |
Purity | ≥95% |
IUPAC Name | 1,2-dibromonaphthalene |
InChI | InChI=1S/C10H6Br2/c11-9-6-5-7-3-1-2-4-8(7)10(9)12/h1-6H |
InChIKey | QGZAUMUFTXCDBD-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |