For research use only. Not for therapeutic Use.
1,2-Dibromotetrafluorobenzene（Cat No.:L020576）is a halogenated aromatic compound characterized by the presence of two bromine atoms and four fluorine atoms on a benzene ring. This compound is commonly used as an intermediate in organic synthesis, particularly in the development of pharmaceuticals, agrochemicals, and advanced materials. The presence of bromine and fluorine atoms enhances its reactivity, making it valuable for cross-coupling reactions and other chemical modifications. 1,2-Dibromotetrafluorobenzene is essential for researchers and chemists focused on creating complex molecules and exploring new synthetic pathways.
| Catalog Number | L020576 |
| CAS Number | 827-08-7 |
| Molecular Formula | C6Br2F4 |
| Purity | ≥95% |
| IUPAC Name | 1,2-dibromo-3,4,5,6-tetrafluorobenzene |
| InChI | InChI=1S/C6Br2F4/c7-1-2(8)4(10)6(12)5(11)3(1)9 |
| InChIKey | IPLUWQPTPKNBRD-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)Br)Br)F)F)F |
