For research use only. Not for therapeutic Use.
1,2-Difluoro-4-(isocyano(tosyl)methyl)benzene is an aromatic compound featuring two fluorine atoms at the 1 and 2-positions and an isocyano group attached to a tosyl (p-toluenesulfonyl) moiety at the 4-position. This compound is significant in organic synthesis and medicinal chemistry due to its potential biological activities and its utility as a versatile building block. The presence of the fluorine atoms enhances its reactivity and lipophilicity, making it valuable in the development of novel therapeutic agents and advanced materials.
CAS Number | 321345-37-3 |
Molecular Formula | C15H11F2NO2S |
Purity | ≥95% |
IUPAC Name | 1,2-difluoro-4-[isocyano-(4-methylphenyl)sulfonylmethyl]benzene |
InChI | InChI=1S/C15H11F2NO2S/c1-10-3-6-12(7-4-10)21(19,20)15(18-2)11-5-8-13(16)14(17)9-11/h3-9,15H,1H3 |
InChIKey | DUHMNGGUXBLMCW-UHFFFAOYSA-N |
SMILES | CC1=CC=C(C=C1)S(=O)(=O)C(C2=CC(=C(C=C2)F)F)[N+]#[C-] |