Home
>
Reference Standards> 1,2-Difluoro-4-[trans-4-[2-(trans-4-propylcyclohexyl)ethyl]cyclohexyl]benzene
For research use only. Not for therapeutic Use.
1,2-Difluoro-4-[trans-4-[2-(trans-4-propylcyclohexyl)ethyl]cyclohexyl]benzene is a complex aromatic compound featuring a benzene ring substituted with two fluorine atoms at the 1 and 2 positions. The molecule also includes a trans-4-alkyl cyclohexyl group, providing a unique three-dimensional structure. This arrangement contributes to its distinct physical and chemical properties, making it potentially valuable in materials science and organic synthesis. The compound’s versatility allows for various modifications, facilitating exploration in fields like drug development and advanced material applications.
CAS Number | 117943-37-0 |
Molecular Formula | C23H34F2 |
Purity | ≥95% |
Storage | -80°C |
IUPAC Name | 1,2-difluoro-4-[4-[2-(4-propylcyclohexyl)ethyl]cyclohexyl]benzene |
InChI | InChI=1S/C23H34F2/c1-2-3-17-4-6-18(7-5-17)8-9-19-10-12-20(13-11-19)21-14-15-22(24)23(25)16-21/h14-20H,2-13H2,1H3 |
InChIKey | HTAPXFSKUGZEEP-UHFFFAOYSA-N |
SMILES | CCCC1CCC(CC1)CCC2CCC(CC2)C3=CC(=C(C=C3)F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |