For research use only. Not for therapeutic Use.
1,2-Dihydroperillic Acid (Cat No.:C001103) is a chemical compound and a derivative of perillic acid. It contains a hydroperoxy group attached to the perillic acid structure. This compound is a key intermediate in the biosynthesis of limonoids, which are natural compounds found in certain plants. It may also have potential applications in organic synthesis and chemical research as a building block for the preparation of other compounds.
| Catalog Number | C001103 |
| CAS Number | 32676-16-7 |
| Synonyms | 4-(1-Methylethenyl)cyclohexanecarboxylic Acid; |
| Molecular Formula | C₁₀H₁₆O₂ |
| Purity | ≥95% |
| Solubility | Chloroform (Slightly), Methanol (Slightly) |
| Appearance | White to Off-White Solid |
| Storage | -20°C |
| IUPAC Name | 4-prop-1-en-2-ylcyclohexane-1-carboxylic acid |
| InChI | InChI=1S/C10H16O2/c1-7(2)8-3-5-9(6-4-8)10(11)12/h8-9H,1,3-6H2,2H3,(H,11,12) |
| InChIKey | XZOBEDLKVOHSSH-UHFFFAOYSA-N |
| SMILES | CC(=C)C1CCC(CC1)C(=O)O |
