Home
>
Chemical Reagents>Heterocyclic Building Blocks> 1',2'-Dihydrospiro[cyclopentane-1,3'-indole]-2'-one
For research use only. Not for therapeutic Use.
1′,2′-Dihydrospiro[cyclopentane-1,3′-indole]-2′-one(Cat No.:L007224), is a chemical compound. It possesses a spiro[cyclopentane-1,3′-indole] core—a bicyclic structure comprised of a cyclopentane ring fused with an indole ring—substituted with a ketone group at the 2′-position. This compound is significant in organic synthesis and medicinal chemistry research. Its unique spirocyclic structure makes it valuable for designing novel bioactive molecules. Researchers explore derivatives of this compound for various pharmacological applications, contributing to drug discovery efforts and advancements in medicinal chemistry, leading to potential applications in the development of pharmaceuticals and biologically active compounds.
Catalog Number | L007224 |
CAS Number | 41058-67-7 |
Molecular Formula | C12H13NO |
Purity | ≥95% |
IUPAC Name | spiro[1H-indole-3,1'-cyclopentane]-2-one |
InChI | InChI=1S/C12H13NO/c14-11-12(7-3-4-8-12)9-5-1-2-6-10(9)13-11/h1-2,5-6H,3-4,7-8H2,(H,13,14) |
InChIKey | WFPNMCKAQLBEMD-UHFFFAOYSA-N |
SMILES | C1CCC2(C1)C3=CC=CC=C3NC2=O |