For research use only. Not for therapeutic Use.
1,2-Dihydroxy-3,5-diformylbenzene(Cat No.:L007469), is a chemical compound characterized by a benzene ring with two hydroxyl (-OH) groups and two aldehyde (-CHO) groups located at the 3rd and 5th positions. This unique molecular structure makes it valuable in various chemical and biochemical processes. Scientists often use it as a reagent in organic synthesis for the formation of complex organic compounds due to its reactive aldehyde groups. Additionally, it plays a role in biological processes, serving as a precursor in the synthesis of natural products and pharmaceuticals. Its versatile reactivity and importance in chemical research make it a valuable compound in both laboratory settings and industrial applications.
CAS Number | 116315-07-2 |
Molecular Formula | C8H6O4 |
Purity | ≥95% |
IUPAC Name | 4,5-dihydroxybenzene-1,3-dicarbaldehyde |
InChI | InChI=1S/C8H6O4/c9-3-5-1-6(4-10)8(12)7(11)2-5/h1-4,11-12H |
InChIKey | YZJVWIUMDDXVEA-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C(=C1C=O)O)O)C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |