1,2-Dioleoyl-sn-glycerol is a diacylglycerol (Cat No.:R027293) molecule composed of two oleic acid chains attached to a glycerol backbone. It is a key intermediate in lipid metabolism and plays a significant role in cellular signaling, particularly in the activation of protein kinase C (PKC). This compound is widely studied for its involvement in processes such as membrane dynamics, signal transduction, and energy storage. Due to its role in regulating metabolic pathways and gene expression, 1,2-Dioleoyl-sn-glycerol is essential in research focused on metabolic disorders, obesity, and cardiovascular diseases.
| Catalog Number | R027293 |
| CAS Number | 24529-88-2 |
| Synonyms | (9Z)-9-Octadecenoic Acid (1S)-1-(Hydroxymethyl)-1,2-ethanediyl Ester; (S)-(Z)-9-Octadecenoic Acid 1-(Hydroxymethyl)-1,2-ethanediyl Ester; (S)-(-)-1,2-Di-olein; 1,2-Di-O-oleoyl-sn-glycerol; 1,2-Dioleoyl-sn-glycerol; sn-1,2-Diolein; sn-1,2-Dioleoylglyc |
| Molecular Formula | C39H72O5 |
| Purity | 95% |
| Storage | -20°C |
| IUPAC Name | [(2S)-3-hydroxy-2-[(Z)-octadec-9-enoyl]oxypropyl] (Z)-octadec-9-enoate |
| InChI | InChI=1S/C39H72O5/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-38(41)43-36-37(35-40)44-39(42)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,37,40H,3-16,21-36H2,1-2H3/b19-17-,20-18-/t37-/m0/s1 |
| InChIKey | AFSHUZFNMVJNKX-LLWMBOQKSA-N |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCC(CO)OC(=O)CCCCCCCC=CCCCCCCCC |
