For research use only. Not for therapeutic Use.
1,2-Diphenylpropene (Cat.No:L003754) is a significant organic compound with diverse applications in chemical synthesis. Its double bond and phenyl groups confer unique reactivity, making it a crucial intermediate in the preparation of various specialty chemicals. This compound serves as a key building block in the synthesis of pharmaceuticals, agrochemicals, and materials. Its versatile nature and widespread use underscore its importance in contemporary organic chemistry research and industrial processes.
Catalog Number | L003754 |
CAS Number | 833-81-8 |
Molecular Formula | C15H14 |
Purity | ≥95% |
IUPAC Name | [(E)-1-phenylprop-1-en-2-yl]benzene |
InChI | InChI=1S/C15H14/c1-13(15-10-6-3-7-11-15)12-14-8-4-2-5-9-14/h2-12H,1H3/b13-12+ |
InChIKey | OVZXISBUYCEVEV-OUKQBFOZSA-N |
SMILES | C/C(=CC1=CC=CC=C1)/C2=CC=CC=C2 |