For research use only. Not for therapeutic Use.
1,2-Di(pyridin-4-yl)ethyne(Cat No.:L041090)is an organic compound featuring a central ethynyl linkage between two 4-pyridyl groups, with the molecular formula C12H8N2. This bipyridyl ligand is highly valued in coordination chemistry for its ability to form complex structures with metals, leading to applications in catalysis and materials science. Its rigid linear structure and electron-rich nitrogen sites make it ideal for constructing coordination polymers and metal-organic frameworks (MOFs) that are used in gas storage, separation technologies, and as catalysts in organic synthesis. The compound’s versatility makes it a fundamental building block in advanced molecular engineering.
CAS Number | 73564-69-9 |
Molecular Formula | C12H8N2 |
Purity | ≥95% |
IUPAC Name | 4-(2-pyridin-4-ylethynyl)pyridine |
InChI | InChI=1S/C12H8N2/c1(11-3-7-13-8-4-11)2-12-5-9-14-10-6-12/h3-10H |
InChIKey | SPKCEACOZLCRSV-UHFFFAOYSA-N |
SMILES | C1=CN=CC=C1C#CC2=CC=NC=C2 |