For research use only. Not for therapeutic Use.
1,2-Indanedione(Cat No.:M085614)is a high-purity chemical compound widely used in forensic science and pharmaceutical research. It is renowned for its ability to develop latent fingerprints on porous surfaces by reacting with amino acids in sweat, making it invaluable in criminal investigations. In pharmaceutical research, 1,2-Indanedione serves as a key intermediate in the synthesis of various bioactive compounds and drugs. Its precise reactivity and stability make it essential for producing reliable results in both forensic and chemical analyses, highlighting its importance in advancing scientific investigations and drug development.
CAS Number | 16214-27-0 |
Synonyms | 1H-Indene-1,2(3H)-dione; Indan-1,2-dione. |
Molecular Formula | C9H6O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3H-indene-1,2-dione |
InChI | InChI=1S/C9H6O2/c10-8-5-6-3-1-2-4-7(6)9(8)11/h1-4H,5H2 |
InChIKey | WFFZGYRTVIPBFN-UHFFFAOYSA-N |
SMILES | C1C2=CC=CC=C2C(=O)C1=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |