For research use only. Not for therapeutic Use.
1,2-Propylene-d6 carbonate(Cat No.:R003476)is a deuterated form of 1,2-propylene carbonate, a cyclic ester used as a solvent and electrolyte in lithium-ion batteries and in the synthesis of chemicals. The “d6” designation refers to the presence of six deuterium atoms replacing hydrogen in the molecular structure. This compound is used in studies where isotope labeling is required to track molecular interactions or reactions. It offers the same functional properties as the non-deuterated version, with the added benefit of enabling advanced analytical techniques like NMR spectroscopy.
CAS Number | 202480-74-8 |
Synonyms | 4,4,5-trideuterio-5-(trideuteriomethyl)-1,3-dioxolan-2-one |
Molecular Formula | C4D6O3 |
Purity | ≥95% |
IUPAC Name | 4,4,5-trideuterio-5-(trideuteriomethyl)-1,3-dioxolan-2-one |
InChI | InChI=1S/C4H6O3/c1-3-2-6-4(5)7-3/h3H,2H2,1H3/i1D3,2D2,3D |
InChIKey | RUOJZAUFBMNUDX-LIDOUZCJSA-N |
SMILES | [2H]C1(C(OC(=O)O1)([2H])C([2H])([2H])[2H])[2H] |