1,2,3-Trichloropropane (TCP) is a hazardous organic compound with widespread industrial use. This dense, colorless liquid, characterized by a sweet odor, is primarily employed as a solvent, intermediate in chemical synthesis, and in pesticide formulations. Despite its utility, TCP is a known carcinogen and poses significant environmental and health risks. It contaminates soil and groundwater, persisting for long periods due to its low biodegradability. Strict regulations govern its handling and disposal to mitigate its adverse effects on human health and the environment, emphasizing the importance of alternative, less harmful substances.
| Catalog Number | R069020 |
| CAS Number | 96-18-4 |
| Synonyms | Allyl trichloride, Glycerol trichlorohydrin |
| Molecular Formula | C3H5Cl3 |
| Purity | ≥95% |
| Storage | RT |
| IUPAC Name | 1,2,3-trichloropropane |
| InChI | InChI=1S/C3H5Cl3/c4-1-3(6)2-5/h3H,1-2H2 |
| InChIKey | CFXQEHVMCRXUSD-UHFFFAOYSA-N |
| SMILES | C(C(CCl)Cl)Cl |
