For research use only. Not for therapeutic Use.
1,2,3,4-Butanetetracarboxylic acid (Cat No.:M122082) is an organic compound. It is a white crystalline solid that belongs to the class of carboxylic acids. The compound contains four carboxylic acid functional groups attached to a central butane-like backbone. It is primarily used in the synthesis of coordination compounds and polymers due to its ability to form complex structures with metal ions. Additionally, it finds applications in the production of specialty chemicals and materials.
CAS Number | 1703-58-8 |
Molecular Formula | C8H10O8 |
Purity | ≥95% |
Storage | Room Temperature |
IUPAC Name | butane-1,2,3,4-tetracarboxylic acid |
InChI | InChI=1S/C8H10O8/c9-5(10)1-3(7(13)14)4(8(15)16)2-6(11)12/h3-4H,1-2H2,(H,9,10)(H,11,12)(H,13,14)(H,15,16) |
InChIKey | GGAUUQHSCNMCAU-UHFFFAOYSA-N |
SMILES | C(C(C(CC(=O)O)C(=O)O)C(=O)O)C(=O)O |