For research use only. Not for therapeutic Use.
1,2,3,4-Tetrahydro-4,6-dihydroxy-2-methyl-isoquinoline (Cat No.:R013354) is a chemical compound with the molecular formula C10H13NO2. It is an isoquinoline derivative that contains a tetrahydro-4,6-dihydroxy-2-methyl structure. This compound is of interest due to its potential applications in pharmaceutical and medicinal chemistry. Isoquinoline derivatives often exhibit diverse biological activities, and this compound’s unique structure may contribute to its pharmacological properties. Researchers may explore its synthesis, properties, and potential uses for the development of new drugs or as building blocks in organic synthesis.
CAS Number | 23824-24-0 |
Synonyms | 1,2,3,4-Tetrahydro-2-methyl-4,6-isoquinolinediol; 1,2,3,4-Tetrahydro-4,6-dihydroxy-2-methylisoquinoline; 4,6-Dihydroxy-2-methyl-1,2,3,4-tetrahydroisoquinoline; |
Molecular Formula | C10H13NO2 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 2-methyl-3,4-dihydro-1H-isoquinoline-4,6-diol |
InChI | InChI=1S/C10H13NO2/c1-11-5-7-2-3-8(12)4-9(7)10(13)6-11/h2-4,10,12-13H,5-6H2,1H3 |
InChIKey | GXNCQQCQUUCKLX-UHFFFAOYSA-N |
SMILES | CN1CC(C2=C(C1)C=CC(=C2)O)O |