For research use only. Not for therapeutic Use.
1,2,3,4-Tetrahydroquinoline (CAT: R035596) is a bicyclic organic compound, belonging to the class of tetrahydroquinolines. This versatile molecule has been of interest for its potential applications, displaying diverse properties. Tetrahydroquinolines, including 1,2,3,4-tetrahydroquinoline, have been explored for their biological activities, making them valuable in medicinal chemistry and other research domains. This compound’s structural diversity has led to its utilization as a building block for synthesizing pharmaceutical compounds and bioactive molecules. Additionally, investigations into its interactions with receptors and enzymes contribute to its significance in drug discovery.
| CAS Number | 635-46-1 |
| Synonyms | 1,2,3,4-Hydroquinoline; 3,4-Dihydro-2H-quinoline; Kusol; NSC 15311; THQ |
| Molecular Formula | C9H11N |
| Purity | ≥95% |
| Storage | Store at -20℃ |
| IUPAC Name | 1,2,3,4-tetrahydroquinoline |
| InChI | InChI=1S/C9H11N/c1-2-6-9-8(4-1)5-3-7-10-9/h1-2,4,6,10H,3,5,7H2 |
| InChIKey | LBUJPTNKIBCYBY-UHFFFAOYSA-N |
| SMILES | C1CC2=CC=CC=C2NC1 |
