For research use only. Not for therapeutic Use.
1,2,3,4,6-Penta-O-benzoyl-D-mannopyranose is a fully benzoylated derivative of D-mannose, featuring benzoyl ester groups attached to all five hydroxyl positions of the sugar. This compound is primarily used as an intermediate in carbohydrate chemistry, particularly for glycosylation reactions in the synthesis of oligosaccharides and glycoconjugates. Its protected form enhances stability and prevents unwanted side reactions during chemical transformations. This makes it valuable in the development of pharmaceuticals, biomolecules, and complex carbohydrate-based structures for biological research.
CAS Number | 96996-90-6 |
Synonyms | 1,2,3,4,6-Pentabenzoate D-Mannopyranose; D-Mannose Pentabenzoate; |
Molecular Formula | C41H32O11 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | [(2R,3R,4S,5S)-3,4,5,6-tetrabenzoyloxyoxan-2-yl]methyl benzoate |
InChI | InChI=1S/C41H32O11/c42-36(27-16-6-1-7-17-27)47-26-32-33(49-37(43)28-18-8-2-9-19-28)34(50-38(44)29-20-10-3-11-21-29)35(51-39(45)30-22-12-4-13-23-30)41(48-32)52-40(46)31-24-14-5-15-25-31/h1-25,32-35,41H,26H2/t32-,33-,34+,35+,41?/m1/s1 |
InChIKey | JJNMLNFZFGSWQR-HKNOGKPYSA-N |
SMILES | C1=CC=C(C=C1)C(=O)OCC2C(C(C(C(O2)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5)OC(=O)C6=CC=CC=C6 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |