For research use only. Not for therapeutic Use.
1,2,4-Trichloro-5-iodobenzene is a halogenated aromatic compound featuring three chlorine atoms and one iodine atom attached to a benzene ring. This compound is valuable in organic synthesis, particularly for creating more complex molecules through halogen-exchange reactions and cross-coupling techniques. Its unique halogen pattern makes it useful for designing novel materials, pharmaceuticals, and agrochemicals. Researchers explore its role in synthetic methodologies, including its potential use in catalysis and its applications in developing biologically active compounds for therapeutic research.
CAS Number | 7145-82-6 |
Synonyms | 2,4,5-Trichloro-1-iodobenzene; 2,4,5-Trichloroiodobenzene; NSC 74997 |
Molecular Formula | C6H2Cl3I |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1,2,4-trichloro-5-iodobenzene |
InChI | InChI=1S/C6H2Cl3I/c7-3-1-5(9)6(10)2-4(3)8/h1-2H |
InChIKey | KKXMBRLCXIPURK-UHFFFAOYSA-N |
SMILES | C1=C(C(=CC(=C1Cl)I)Cl)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |