For research use only. Not for therapeutic Use.
1,2,4,5-Benzenetetrathiol(Cat No.:M009183) is a unique organic compound characterized by a benzene ring substituted with four thiol groups attached at the 1, 2, 4, and 5 positions. This arrangement makes it highly reactive due to the presence of sulfur in the thiol groups, which can readily form bonds with metals and other electrophiles. Its chemical properties make it particularly useful in materials science, especially in the synthesis of metal-organic frameworks (MOFs) and conducting polymers. These frameworks and polymers have potential applications in catalysis, gas storage, and as sensors due to their porous and conductive nature.
CAS Number | 20133-21-5 |
Synonyms | 1,2,4,5-Benzenetetrathiol |
Molecular Formula | C6H6S4 |
Purity | ≥95% |
Documentation | |
Storage | Store at -20°C |
IUPAC Name | benzene-1,2,4,5-tetrathiol |
InChI | InChI=1S/C6H6S4/c7-3-1-4(8)6(10)2-5(3)9/h1-2,7-10H |
InChIKey | KVPDTCNNKWOGMZ-UHFFFAOYSA-N |
SMILES | C1=C(C(=CC(=C1S)S)S)S |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |