Home
>
Chemical Reagents>Heterocyclic Building Blocks> [1,2,4]Triazolo[1,5-a]pyridine-6-carbaldehyde
For research use only. Not for therapeutic Use.
[1,2,4]Triazolo[1,5-a]pyridine-6-carbaldehyde(Cat No.:L047911)is a heterocyclic compound featuring a triazole fused to a pyridine ring with an aldehyde group at the 6-position. This compound is valuable in pharmaceutical research as a key intermediate in the synthesis of bioactive molecules, including antiviral, anticancer, and antimicrobial agents. Its unique structure allows for versatile chemical modifications, making it useful in drug discovery and development. With high reactivity and purity, [1,2,4]Triazolo[1,5-a]pyridine-6-carbaldehyde supports advanced research in medicinal chemistry and organic synthesis.
CAS Number | 614750-81-1 |
Molecular Formula | C7H5N3O |
Purity | ≥95% |
IUPAC Name | [1,2,4]triazolo[1,5-a]pyridine-6-carbaldehyde |
InChI | InChI=1S/C7H5N3O/c11-4-6-1-2-7-8-5-9-10(7)3-6/h1-5H |
InChIKey | SYLGZKAGHAOGFM-UHFFFAOYSA-N |
SMILES | C1=CC2=NC=NN2C=C1C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |