For research use only. Not for therapeutic Use.
1,2,5-Trichloro-3-iodobenzene(CAT: L023035) is a halogenated aromatic compound featuring three chlorine atoms and one iodine atom on a benzene ring. Its unique halogen substitution pattern makes it a highly versatile intermediate in organic synthesis and pharmaceutical research. The iodine atom, being highly reactive, allows for selective transformations such as cross-coupling reactions (e.g., Suzuki-Miyaura, Sonogashira) or nucleophilic substitutions, while the chlorine atoms provide additional functionalization opportunities. This compound is valuable for constructing complex molecules, including heterocyclic frameworks and bioactive compounds, and is ideal for medicinal chemistry and material science applications. 1,2,5-Trichloro-3-iodobenzene offers excellent stability and reactivity, enabling precision-driven chemical transformations.
CAS Number | 216393-66-7 |
Molecular Formula | C6H2Cl3I |
Purity | ≥95% |
IUPAC Name | 1,2,5-trichloro-3-iodobenzene |
InChI | InChI=1S/C6H2Cl3I/c7-3-1-4(8)6(9)5(10)2-3/h1-2H |
InChIKey | YLLMVDOSVGVBJC-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C(=C1Cl)Cl)I)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |