For research use only. Not for therapeutic Use.
12R-LOX-IN-2(CAT: I040721) is a potent and selective inhibitor of 12R-lipoxygenase (12R-LOX), an enzyme involved in the epidermal lipoxygenase pathway critical for skin barrier formation and function. By targeting 12R-LOX, this compound is used to study lipid metabolism, skin differentiation, and disorders such as ichthyosis and atopic dermatitis. 12R-LOX-IN-2 is valuable in dermatological research for exploring therapeutic approaches aimed at modulating epidermal lipid processing and inflammatory responses. Its specificity makes it ideal for dissecting the biological role of 12R-LOX without affecting other lipoxygenase isoforms.
| CAS Number | 3026677-37-9 |
| Synonyms | 4-quinolin-2-ylnaphthalen-1-ol |
| Molecular Formula | C19H13NO |
| Purity | ≥95% |
| IUPAC Name | 4-quinolin-2-ylnaphthalen-1-ol |
| InChI | InChI=1S/C19H13NO/c21-19-12-10-15(14-6-2-3-7-16(14)19)18-11-9-13-5-1-4-8-17(13)20-18/h1-12,21H |
| InChIKey | PLATVCRZPNTREE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=N2)C3=CC=C(C4=CC=CC=C43)O |
