For research use only. Not for therapeutic Use.
1,3-Adamantanediol monoacrylate (Cat.No:M017191) is a specialized chemical compound used in polymerization reactions. Its unique structure, derived from adamantane, imparts exceptional rigidity and stability to polymers. This acrylate derivative finds applications in the development of advanced materials and high-performance polymers for various industrial uses.
CAS Number | 115372-36-6 |
Molecular Formula | C14H20O3 |
Purity | ≥95% |
Storage | Store at +4C |
IUPAC Name | (3-hydroxy-1-adamantyl) 2-methylprop-2-enoate |
InChI | InChI=1S/C14H20O3/c1-9(2)12(15)17-14-6-10-3-11(7-14)5-13(16,4-10)8-14/h10-11,16H,1,3-8H2,2H3 |
InChIKey | OOIBFPKQHULHSQ-UHFFFAOYSA-N |
SMILES | CC(=C)C(=O)OC12CC3CC(C1)CC(C3)(C2)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |