For research use only. Not for therapeutic Use.
1,3-Benzenedicarbonitrile, 4,6-difluoro- (Cat.No:L003384) is a notable chemical compound with applications in pharmaceutical and agrochemical industries. Its unique structure, featuring fluorine substitutions, imparts valuable properties for drug design and crop protection. This compound serves as a crucial building block in the synthesis of specialized molecules, showcasing its significance in the development of innovative chemicals for diverse applications.
Catalog Number | L003384 |
CAS Number | 17654-70-5 |
Molecular Formula | C8H2F2N2 |
Purity | ≥95% |
IUPAC Name | 4,6-difluorobenzene-1,3-dicarbonitrile |
InChI | InChI=1S/C8H2F2N2/c9-7-2-8(10)6(4-12)1-5(7)3-11/h1-2H |
InChIKey | UAKXPKOAUDLYKN-UHFFFAOYSA-N |
SMILES | C1=C(C(=CC(=C1C#N)F)F)C#N |