For research use only. Not for therapeutic Use.
1,3-Benzodioxole-5-sulfonyl chloride is a crucial chemical reagent used in organic synthesis and pharmaceutical research. It contains a sulfonyl chloride functional group and is derived from benzodioxole, a compound commonly found in natural products. This reagent’s significance lies in its ability to facilitate the synthesis of complex organic molecules with potential biological activities. Chemists employ it as a key intermediate, enabling the creation of diverse compounds, including pharmaceuticals and agrochemicals.
CAS Number | 115010-10-1 |
Synonyms | 5-Benzodioxolesulfonyl Chloride |
Molecular Formula | C7H5ClO4S |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1,3-benzodioxole-5-sulfonyl chloride |
InChI | InChI=1S/C7H5ClO4S/c8-13(9,10)5-1-2-6-7(3-5)12-4-11-6/h1-3H,4H2 |
InChIKey | ICUBASIDCXDQAW-UHFFFAOYSA-N |
SMILES | C1OC2=C(O1)C=C(C=C2)S(=O)(=O)Cl |