For research use only. Not for therapeutic Use.
1,3-BIS(3-AMINOPHENOXY)BENZENE (Cat.No:M051324) is a chemical compound utilized in organic synthesis and polymer chemistry. With two amino-phenoxy groups, it functions as a versatile building block for various molecular structures. Its applications range from developing functional materials to designing ligands for coordination chemistry and catalysis.
CAS Number | 10526-07-5 |
Synonyms | 3,3′-(1,3-Phenylenebis(oxy))dianiline; Benzenamine, 3,3′-[1,3-phenylenebis(oxy)]bis-; 1,3-bis-(3-Aminophenoxy)benzene |
Molecular Formula | C18H16N2O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3-[3-(3-aminophenoxy)phenoxy]aniline |
InChI | InChI=1S/C18H16N2O2/c19-13-4-1-6-15(10-13)21-17-8-3-9-18(12-17)22-16-7-2-5-14(20)11-16/h1-12H,19-20H2 |
InChIKey | DKKYOQYISDAQER-UHFFFAOYSA-N |
SMILES | C1=CC(=CC(=C1)OC2=CC(=CC=C2)OC3=CC=CC(=C3)N)N |
Reference | <span style=”font-family:arial,helvetica,sans-serif;”><span style=”font-size:12px;”>1.<span style=”font-variant-ligatures: normal; orphans: 2; widows: 2;”>Jensen, Brian J. "Method to prepare processable polyimides with reactive endgroups using 1, 3-bis (3-aminophenoxy) benzene." U.S. Patent No. 6,133,401. 17 Oct. 2000.</span></span></span> |