For research use only. Not for therapeutic Use.
1,3-bis((1H-imidazol-1-yl)methyl)benzene (Cat.No:L003787) is a significant compound in coordination chemistry. Its distinctive structure, featuring imidazole groups, imparts unique coordination properties. This compound serves as a valuable ligand in the synthesis of metal complexes with applications in catalysis and materials science. Its versatile nature and ability to facilitate diverse reactions highlight its importance in contemporary chemical research
Catalog Number | L003787 |
CAS Number | 69506-92-9 |
Molecular Formula | C14H14N4 |
Purity | ≥95% |
IUPAC Name | 1-[[3-(imidazol-1-ylmethyl)phenyl]methyl]imidazole |
InChI | InChI=1S/C14H14N4/c1-2-13(9-17-6-4-15-11-17)8-14(3-1)10-18-7-5-16-12-18/h1-8,11-12H,9-10H2 |
InChIKey | HGYFIFXDQPTNHU-UHFFFAOYSA-N |
SMILES | C1=CC(=CC(=C1)CN2C=CN=C2)CN3C=CN=C3 |