Home
>
Catalysts and Ligands>Nonchiral nitrogen ligands> 1,3-Bis(2,4,6-trimethylphenyl)imidazolium bicarbonate
For research use only. Not for therapeutic Use.
1,3-Bis(2,4,6-trimethylphenyl)imidazolium bicarbonate (Cat.No:L003318) is a noteworthy chemical compound with various industrial applications. Known for its stability and versatility, it serves as a key component in the formulation of specialized materials, highlighting its importance in contemporary chemical processes.
Catalog Number | L003318 |
CAS Number | 1372124-93-0 |
Molecular Formula | C22H26N2O3 |
Purity | ≥95% |
IUPAC Name | 1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium;hydrogen carbonate |
InChI | InChI=1S/C21H25N2.CH2O3/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6;2-1(3)4/h7-13H,1-6H3;(H2,2,3,4)/q+1;/p-1 |
InChIKey | XLNGZTAIJOOIFH-UHFFFAOYSA-M |
SMILES | CC1=CC(=C(C(=C1)C)N2C=C[N+](=C2)C3=C(C=C(C=C3C)C)C)C.C(=O)(O)[O-] |